biopax3:ChemicalStructure | rdf:type | owl:Class | lld:biopax3 |
biopax3:ChemicalStructure | rdf:type | owl:Class | lld:intact |
biopax3:ChemicalStructure | rdf:type | owl:Class | lld:mint |
biopax3:ChemicalStructure | rdfs:comment | Definition: The chemical structure of a small molecule.
Usage: Structure information is stored in the property structureData, in one of three formats: the CML format (see URL www.xml-cml.org), the SMILES format (see URL www.daylight.com/dayhtml/smiles/) or the InChI format (http://www.iupac.org/inchi/). The structureFormat property specifies which format is used.
Examples: The following SMILES string describes the structure of glucose-6-phosphate:
'C(OP(=O)(O)O)[CH]1([CH](O)[CH](O)[CH](O)[CH](O)O1)'. | lld:biopax3 |
biopax3:ChemicalStructure | rdfs:comment | Definition: The chemical structure of a small molecule.
Usage: Structure information is stored in the property structureData, in one of three formats: the CML format (see URL www.xml-cml.org), the SMILES format (see URL www.daylight.com/dayhtml/smiles/) or the InChI format (http://www.iupac.org/inchi/). The structureFormat property specifies which format is used.
Examples: The following SMILES string describes the structure of glucose-6-phosphate:
'C(OP(=O)(O)O)[CH]1([CH](O)[CH](O)[CH](O)[CH](O)O1)'. | lld:intact |
biopax3:ChemicalStructure | rdfs:comment | Definition: The chemical structure of a small molecule.
Usage: Structure information is stored in the property structureData, in one of three formats: the CML format (see URL www.xml-cml.org), the SMILES format (see URL www.daylight.com/dayhtml/smiles/) or the InChI format (http://www.iupac.org/inchi/). The structureFormat property specifies which format is used.
Examples: The following SMILES string describes the structure of glucose-6-phosphate:
'C(OP(=O)(O)O)[CH]1([CH](O)[CH](O)[CH](O)[CH](O)O1)'. | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:SequenceLocation | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:SequenceLocation | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:SequenceLocation | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityFeature | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityFeature | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityFeature | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:PathwayStep | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:PathwayStep | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:PathwayStep | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:BioSource | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:BioSource | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:BioSource | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ControlledVocabular... | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ControlledVocabular... | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ControlledVocabular... | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:DeltaG | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:DeltaG | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:DeltaG | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityReference | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityReference | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:EntityReference | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Evidence | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Evidence | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Evidence | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ExperimentalForm | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ExperimentalForm | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:ExperimentalForm | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:KPrime | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:KPrime | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:KPrime | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Provenance | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Provenance | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Provenance | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Score | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Score | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Score | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Stoichiometry | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Stoichiometry | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Stoichiometry | lld:mint |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Xref | lld:biopax3 |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Xref | lld:intact |
biopax3:ChemicalStructure | owl:disjointWith | biopax3:Xref | lld:mint |
biopax3:ChemicalStructure | rdfs:subClassOf | biopax3:UtilityClass | lld:biopax3 |
biopax3:ChemicalStructure | rdfs:subClassOf | biopax3:UtilityClass | lld:intact |
biopax3:ChemicalStructure | rdfs:subClassOf | biopax3:UtilityClass | lld:mint |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
http://biocyc.org/biopax/bi... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |
urn:biopax:ChemicalStructur... | rdf:type | biopax3:ChemicalStructure | lld:biopax3 |