Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:66919
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:66919 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:66919 | skos:definition | "A pyrazole substituted at position 1 by a 2-cyano-1-cyclopentylethyl group and at position 3 by a pyrrolo[2,3-d]pyrimidin-4-yl group. Used as the phosphate salt for the treatment of patients with intermediate or high-risk myelofibrosis, including primary myelofibrosis, post-polycythemia vera myelofibrosis and post-essential thrombocythemia myelofibrosis." [] | lld:chebi |
| chebi:CHEBI:66919 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:66919 | skos:prefLabel | ruxolitinib | lld:chebi |
| chebi:CHEBI:66919 | skos:altLabel | (3R)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]propanenitrile | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22830345 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22375971 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22544377 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22279053 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | Reaxys:18703668 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | KEGG DRUG:941678-49-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | Patent:US2010190981 "Patent" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22034658 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22227528 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22422826 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | KEGG DRUG:D09959 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | Patent:US2008312258 "Patent" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | Wikipedia:Ruxolitinib "Wikipedia" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:21602517 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22399854 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22718840 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22474318 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | ChemIDplus:941678-49-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:21926964 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22375970 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:21919691 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:notation | CiteXplore:22281165 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66919 | skos:broader | chebi:CHEBI:26410 | lld:chebi |
| chebi:CHEBI:66919 | skos:broader | chebi:CHEBI:18379 | lld:chebi |
| chebi:CHEBI:66919 | skos:broader | chebi:CHEBI:38670 | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | ruxolitinib | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | INCB018424 | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | C17H18N6 | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | N#CC[C@H](C1CCCC1)n1cc(cn1)-c1ncnc2[nH]ccc12 | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | InChI=1S/C17H18N6/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16/h6,8-12,15H,1-5H2,(H,19,20,21)/t15-/m1/s1 | lld:chebi |
| chebi:CHEBI:66919 | skos:relatedSynonym | InChIKey=HFNKQEVNSGCOJV-OAHLLOKOSA-N | lld:chebi |