chebi:CHEBI:66910 | rdf:type | skos:Concept | lld:chebi |
chebi:CHEBI:66910 | skos:definition | "An indazole substituted at position 3 by a 2-(pyridin-2-yl)vinyl group and at position 6 by a 2-(N-methylaminocarboxy)phenylsulfanyl group. Used for the treatment of advanced renal cell carcinoma after failure of a first line systemic treatment." [] | lld:chebi |
chebi:CHEBI:66910 | skos:inScheme | lld:chebi | lld:chebi |
chebi:CHEBI:66910 | skos:prefLabel | axitinib | lld:chebi |
chebi:CHEBI:66910 | skos:altLabel | N-methyl-2-({3-[(E)-2-(pyridin-2-yl)ethenyl]-1H-indazol-6-yl}sulfanyl)benzamide | lld:chebi |
chebi:CHEBI:66910 | skos:notation | KEGG DRUG:D03218 "KEGG DRUG" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | ChemIDplus:319460-85-0 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22683928 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22545314 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:21670972 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | KEGG DRUG:319460-85-0 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22504156 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22787405 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22170007 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22644797 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | Reaxys:11333336 "Reaxys Registry Number" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22706540 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22699078 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | Wikipedia:Axitinib "Wikipedia" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22733795 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:20740300 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:21301929 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22549112 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22168366 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:notation | CiteXplore:22248343 "PubMed citation" | lld:chebi |
chebi:CHEBI:66910 | skos:broader | chebi:CHEBI:26421 | lld:chebi |
chebi:CHEBI:66910 | skos:broader | chebi:CHEBI:37622 | lld:chebi |
chebi:CHEBI:66910 | skos:broader | chebi:CHEBI:35683 | lld:chebi |
chebi:CHEBI:66910 | skos:broader | chebi:CHEBI:62733 | lld:chebi |
chebi:CHEBI:66910 | skos:broader | chebi:CHEBI:38769 | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | axitinib | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | N-methyl-2-({3-[(E)-2-(pyridin-2-yl)vinyl]-1H-indazol-6-yl}sulfanyl)benzamide | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | AG-013736 | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | Inlyta | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | axitinibum | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | C22H18N4OS | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | CNC(=O)c1ccccc1Sc1ccc2c(\\C=C\\c3ccccn3)n[nH]c2c1 | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | InChI=1S/C22H18N4OS/c1-23-22(27)18-7-2-3-8-21(18)28-16-10-11-17-19(25-26-20(17)14-16)12-9-15-6-4-5-13-24-15/h2-14H,1H3,(H,23,27)(H,25,26)/b12-9+ | lld:chebi |
chebi:CHEBI:66910 | skos:relatedSynonym | InChIKey=RITAVMQDGBJQJZ-FMIVXFBMSA-N | lld:chebi |