| chebi:CHEBI:63622 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:63622 | skos:definition | "A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is sustituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias." [] | lld:chebi |
| chebi:CHEBI:63622 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:63622 | skos:prefLabel | sotalol | lld:chebi |
| chebi:CHEBI:63622 | skos:altLabel | N-{4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl}methanesulfonamide | lld:chebi |
| chebi:CHEBI:63622 | skos:altLabel | Sotalol | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | DrugBank:DB00489 "DrugBank" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | CiteXplore:21553267 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | ChemIDplus:3930-20-9 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | CiteXplore:21854895 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | CiteXplore:20562595 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | Wikipedia:Sotalol "Wikipedia" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | KEGG DRUG:D08525 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | Reaxys:2380820 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | KEGG COMPOUND:C07309 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:63622 | skos:notation | KEGG COMPOUND:3930-20-9 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:63622 | skos:broader | chebi:CHEBI:35358 | lld:chebi |
| chebi:CHEBI:63622 | skos:broader | chebi:CHEBI:35681 | lld:chebi |
| chebi:CHEBI:63622 | skos:broader | chebi:CHEBI:23981 | lld:chebi |
| chebi:CHEBI:63622 | skos:broader | chebi:CHEBI:50995 | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | sotalol | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | 4'-(1-hydroxy-2-(isopropylamino)ethyl)methane sulfonanilide | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | beta-cardone | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | sotalolum | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | C12H20N2O3S | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | CC(C)NCC(O)c1ccc(NS(C)(=O)=O)cc1 | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 | lld:chebi |
| chebi:CHEBI:63622 | skos:relatedSynonym | InChIKey=ZBMZVLHSJCTVON-UHFFFAOYSA-N | lld:chebi |
