Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:391960
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:391960 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:391960 | skos:definition | "2-[(3S)-1-Ethylpyrrolidin-3-yl]-2,2-diphenylacetamide in which one of the hydrogens at the 2-position of the ethyl group is substituted by a 2,3-dihydro-1-benzofuran-5-yl group. It is a selective antagonist for the M3 muscarinic acetylcholine receptor, which is primarily responsible for bladder muscle contractions, and is used as the hydrobromide salt in the management of urinary incontinence." [] | lld:chebi |
| chebi:CHEBI:391960 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:391960 | skos:prefLabel | darifenacin | lld:chebi |
| chebi:CHEBI:391960 | skos:altLabel | 2-{(3S)-1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl}-2,2-diphenylacetamide | lld:chebi |
| chebi:CHEBI:391960 | skos:altLabel | DARIFENACIN | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | DrugBank:DB00496 "DrugBank" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | ChemIDplus:133099-04-4 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | CiteXplore:14616424 "PubMed citation" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | Beilstein:8449641 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | KEGG DRUG:D03654 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | Wikipedia:Darifenacin "Wikipedia" | lld:chebi |
| chebi:CHEBI:391960 | skos:notation | ChEMBL:11831911 "PubMed citation" | lld:chebi |
| chebi:CHEBI:391960 | skos:broader | chebi:CHEBI:37622 | lld:chebi |
| chebi:CHEBI:391960 | skos:broader | chebi:CHEBI:38830 | lld:chebi |
| chebi:CHEBI:391960 | skos:broader | chebi:CHEBI:38260 | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | darifenacin | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | (S)-1-(2-(2,3-dihydro-5-benzofuranyl)ethyl)-alpha,alpha-diphenyl-3-pyrrolidineacetamide | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | C28H30N2O2 | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | [H][C@]1(CCN(CCc2ccc3OCCc3c2)C1)C(C(N)=O)(c1ccccc1)c1ccccc1 | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | InChI=1S/C28H30N2O2/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26/h1-12,19,25H,13-18,20H2,(H2,29,31)/t25-/m1/s1 | lld:chebi |
| chebi:CHEBI:391960 | skos:relatedSynonym | InChIKey=HXGBXQDTNZMWGS-RUZDIDTESA-N | lld:chebi |