Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:408174
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:408174 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:408174 | skos:definition | "An N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide in which both of the stereocentres have R configuration. The active enantiomer of formoterol, it is administered by inhalation (generally as the tartrate salt) as a direct-acting sympathomimetic and bronchodilator for the treatment of chronic obstructive pulmonary disease (any progressive respiratory disease that makes it harder to breathe over time, such as chronic bronchitis and emphysema)." [] | lld:chebi |
| chebi:CHEBI:408174 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:408174 | skos:prefLabel | arformoterol | lld:chebi |
| chebi:CHEBI:408174 | skos:altLabel | N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | Patent:US2011014246 "Patent" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | CiteXplore:20214460 "PubMed citation" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | ChemIDplus:67346-49-0 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | KEGG DRUG:D07463 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | DrugBank:67346-49-0 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | Beilstein:7861827 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | DrugBank:DB01274 "DrugBank" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | KEGG DRUG:67346-49-0 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | ChEMBL:15324892 "PubMed citation" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | CiteXplore:18990965 "PubMed citation" | lld:chebi |
| chebi:CHEBI:408174 | skos:notation | CiteXplore:20406080 "PubMed citation" | lld:chebi |
| chebi:CHEBI:408174 | skos:broader | chebi:CHEBI:63082 | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | C19H24N2O4 | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | arformoterol | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | (-)-formoterol | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | (R,R)-formoterol | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | [H]C(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](C)Cc1ccc(OC)cc1 | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m1/s1 | lld:chebi |
| chebi:CHEBI:408174 | skos:relatedSynonym | InChIKey=BPZSYCZIITTYBL-YJYMSZOUSA-N | lld:chebi |