Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:39400
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:39400 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:39400 | skos:definition | "A carboxylic ester resulting from the formal condensation between (1R)-cis-2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)cyclopropanecarboxylic acid and the alcoholic hydroxy group of (2S)-hydroxy(3-phenoxyphenyl)acetonitrile." [] | lld:chebi |
| chebi:CHEBI:39400 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:39400 | skos:prefLabel | tralomethrin | lld:chebi |
| chebi:CHEBI:39400 | skos:altLabel | (S)-cyano(3-phenoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)cyclopropanecarboxylate | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | KEGG COMPOUND:C18413 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | KEGG COMPOUND:66841-25-6 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | Patent:BE873201 "Patent" | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | ChemIDplus:66841-25-6 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | Reaxys:8444068 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:39400 | skos:notation | Patent:US4279835 "Patent" | lld:chebi |
| chebi:CHEBI:39400 | skos:broader | chebi:CHEBI:37141 | lld:chebi |
| chebi:CHEBI:39400 | skos:broader | chebi:CHEBI:33308 | lld:chebi |
| chebi:CHEBI:39400 | skos:broader | chebi:CHEBI:18379 | lld:chebi |
| chebi:CHEBI:39400 | skos:broader | chebi:CHEBI:35618 | lld:chebi |
| chebi:CHEBI:39400 | skos:broader | chebi:CHEBI:51454 | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | EPA Pesticide Chemical Code 121501 | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | tralomethrine | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | (S)-alpha-Cyano-3-phenoxybenzyl (1R)-cis-2,2-dimethyl-3-((RS)-1,2,2,2-tetrabromoethyl)-cyclopropanecarboxylate | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | [(1R,3S)-3-((1'RS)-1',2',2',2'-tetrabromoethyl)]-2,2-dimethylcyclopropanecarboxylic acid (S)-alpha-cyano-3-phenoxybenzyl ester | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | C22H19Br4NO3 | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | CC1(C)[C@@H](C(Br)C(Br)(Br)Br)[C@H]1C(=O)O[C@H](C#N)c1cccc(Oc2ccccc2)c1 | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | InChI=1S/C22H19Br4NO3/c1-21(2)17(19(23)22(24,25)26)18(21)20(28)30-16(12-27)13-7-6-10-15(11-13)29-14-8-4-3-5-9-14/h3-11,16-19H,1-2H3/t16-,17-,18+,19?/m1/s1 | lld:chebi |
| chebi:CHEBI:39400 | skos:relatedSynonym | InChIKey=YWSCPYYRJXKUDB-KAKFPZCNSA-N | lld:chebi |