chebi:CHEBI:9566 | rdf:type | skos:Concept | lld:chebi |
chebi:CHEBI:9566 | skos:definition | "A phenothiazine derivative having a methylsulfanyl subsitituent at the 2-position and a (1-methylpiperidin-2-yl)ethyl] group at the N-10 position." [] | lld:chebi |
chebi:CHEBI:9566 | skos:inScheme | lld:chebi | lld:chebi |
chebi:CHEBI:9566 | skos:prefLabel | thioridazine | lld:chebi |
chebi:CHEBI:9566 | skos:altLabel | 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfanyl)-10H-phenothiazine | lld:chebi |
chebi:CHEBI:9566 | skos:notation | DrugBank:DB00679 "DrugBank" | lld:chebi |
chebi:CHEBI:9566 | skos:notation | CiteXplore:1650428 "PubMed citation" | lld:chebi |
chebi:CHEBI:9566 | skos:notation | Beilstein:94457 "Beilstein Registry Number" | lld:chebi |
chebi:CHEBI:9566 | skos:notation | KEGG DRUG:D00373 "KEGG DRUG" | lld:chebi |
chebi:CHEBI:9566 | skos:notation | ChemIDplus:50-52-2 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:9566 | skos:notation | Wikipedia:Thioridazine "Wikipedia" | lld:chebi |
chebi:CHEBI:9566 | skos:broader | chebi:CHEBI:38093 | lld:chebi |
chebi:CHEBI:9566 | skos:broader | chebi:CHEBI:26151 | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Orsanil | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Mellerette | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Mellaril | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Meleril | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Mallorol | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Melleril | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | thioridazine | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Malloryl | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Thioridazin | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | thioridazinum | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | 10-[2-(1-methyl-2-piperidyl)ethyl]-2-methylsulfanyl-phenothiazine | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Mellaril-S | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | tioridazina | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Mellerets | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | Sonapax | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | 2-Methylmercapto-10-(2-(N-methyl-2-piperidyl)ethyl)phenothiazine | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | 3-Methylmercapto-N-(2'-(N-methyl-2-piperidyl)ethyl)phenothiazine | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | C21H26N2S2 | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | CSc1ccc2Sc3ccccc3N(CCC3CCCCN3C)c2c1 | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | InChI=1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 | lld:chebi |
chebi:CHEBI:9566 | skos:relatedSynonym | InChIKey=KLBQZWRITKRQQV-UHFFFAOYSA-N | lld:chebi |