| chebi:CHEBI:66955 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:66955 | skos:definition | "A member of the class of benzoic acids that is salicylic acid in which the hydrogens ortho- and para- to the carboxy group are replaced by a pentyl and a hydroxy group, respectively." [] | lld:chebi |
| chebi:CHEBI:66955 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:66955 | skos:prefLabel | olivetolic acid | lld:chebi |
| chebi:CHEBI:66955 | skos:altLabel | 2,4-dihydroxy-6-pentylbenzoic acid | lld:chebi |
| chebi:CHEBI:66955 | skos:notation | MetaCyc:CPD-7165 "MetaCyc" | lld:chebi |
| chebi:CHEBI:66955 | skos:notation | CiteXplore:22802619 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66955 | skos:notation | CiteXplore:19454282 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66955 | skos:notation | ChemIDplus:491-72-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:66955 | skos:notation | Reaxys:2807862 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:66955 | skos:broader | chebi:CHEBI:25384 | lld:chebi |
| chebi:CHEBI:66955 | skos:broader | chebi:CHEBI:33572 | lld:chebi |
| chebi:CHEBI:66955 | skos:broader | chebi:CHEBI:22723 | lld:chebi |
| chebi:CHEBI:66955 | skos:broader | chebi:CHEBI:26188 | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | olivetolcarboxylic acid | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | 6-pentyl-beta-resorcylic acid | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | allazetolcarboxylic acid | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | C12H16O4 | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | CCCCCc1cc(O)cc(O)c1C(O)=O | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | InChI=1S/C12H16O4/c1-2-3-4-5-8-6-9(13)7-10(14)11(8)12(15)16/h6-7,13-14H,2-5H2,1H3,(H,15,16) | lld:chebi |
| chebi:CHEBI:66955 | skos:relatedSynonym | InChIKey=SXFKFRRXJUJGSS-UHFFFAOYSA-N | lld:chebi |
