Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:66291
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:66291 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:66291 | skos:definition | "A pyrrolidinone that is pyrrolidine-2,4-dione substituted at position 3 by a deca-2,4,6,8-tetraen-1-ylidene group which in turn is substituted by a hydroxy and methyl substituents at positions 1 and 4 respectively. It is an antibiotic isolated from Penicillium sp." [] | lld:chebi |
| chebi:CHEBI:66291 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:66291 | skos:prefLabel | (3Z)-ravenic acid | lld:chebi |
| chebi:CHEBI:66291 | skos:altLabel | (3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-4-methyldeca-2,4,6,8-tetraen-1-ylidene]pyrrolidine-2,4-dione | lld:chebi |
| chebi:CHEBI:66291 | skos:notation | CiteXplore:12350167 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66291 | skos:notation | Reaxys:9275104 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:66291 | skos:notation | CiteXplore:20066698 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66291 | skos:broader | chebi:CHEBI:38275 | lld:chebi |
| chebi:CHEBI:66291 | skos:broader | chebi:CHEBI:33823 | lld:chebi |
| chebi:CHEBI:66291 | skos:broader | chebi:CHEBI:26177 | lld:chebi |
| chebi:CHEBI:66291 | skos:broader | chebi:CHEBI:67265 | lld:chebi |
| chebi:CHEBI:66291 | skos:relatedSynonym | ravenic acid | lld:chebi |
| chebi:CHEBI:66291 | skos:relatedSynonym | C15H17NO3 | lld:chebi |
| chebi:CHEBI:66291 | skos:relatedSynonym | C\\C=C\\C=C\\C=C(C)\\C=C\\C(O)=C1/C(=O)CNC1=O | lld:chebi |
| chebi:CHEBI:66291 | skos:relatedSynonym | InChI=1S/C15H17NO3/c1-3-4-5-6-7-11(2)8-9-12(17)14-13(18)10-16-15(14)19/h3-9,17H,10H2,1-2H3,(H,16,19)/b4-3+,6-5+,9-8+,11-7+,14-12- | lld:chebi |
| chebi:CHEBI:66291 | skos:relatedSynonym | InChIKey=JJFGJQNWIJPCAN-AJOOJNDDSA-N | lld:chebi |