Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:64921
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:64921 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:64921 | skos:definition | "Benzoic acid substituted with hydroxy groups at C-3 and -4 and with a polyprenyl chain of unspecified length at C-5." [] | lld:chebi |
| chebi:CHEBI:64921 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:64921 | skos:prefLabel | 3,4-dihydroxy-5-polyprenylbenzoic acid | lld:chebi |
| chebi:CHEBI:64921 | skos:broader | chebi:CHEBI:22723 | lld:chebi |
| chebi:CHEBI:64921 | skos:relatedSynonym | C7H6O4(C5H8)n | lld:chebi |
| chebi:CHEBI:64921 | skos:relatedSynonym | InChI=1S/C12H14O4/c1-7(2)3-4-8-5-9(12(15)16)6-10(13)11(8)14/h3,5-6,13-14H,4H2,1-2H3,(H,15,16) | lld:chebi |
| chebi:CHEBI:64921 | skos:relatedSynonym | InChIKey=NMAKQSXJWYBYRF-UHFFFAOYSA-N | lld:chebi |