Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:64901
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:64901 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:64901 | skos:definition | "A carboxamide obtained by formal condensation of the two primary amino groups of spemidine with the carboxy groups from two molecules of 2,5-dihydroxybenzoic acid." [] | lld:chebi |
| chebi:CHEBI:64901 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:64901 | skos:prefLabel | mygalin | lld:chebi |
| chebi:CHEBI:64901 | skos:altLabel | N-[3-({4-[(2,5-dihydroxybenzoyl)amino]butyl}amino)propyl]-2,5-dihydroxybenzamide | lld:chebi |
| chebi:CHEBI:64901 | skos:notation | CiteXplore:17157805 "PubMed citation" | lld:chebi |
| chebi:CHEBI:64901 | skos:broader | chebi:CHEBI:37622 | lld:chebi |
| chebi:CHEBI:64901 | skos:relatedSynonym | N(1),N(8)-bis(2,5-dihydroxybenzoyl)spermidine | lld:chebi |
| chebi:CHEBI:64901 | skos:relatedSynonym | C21H27N3O6 | lld:chebi |
| chebi:CHEBI:64901 | skos:relatedSynonym | Oc1ccc(O)c(c1)C(=O)NCCCCNCCCNC(=O)c1cc(O)ccc1O | lld:chebi |
| chebi:CHEBI:64901 | skos:relatedSynonym | InChI=1S/C21H27N3O6/c25-14-4-6-18(27)16(12-14)20(29)23-10-2-1-8-22-9-3-11-24-21(30)17-13-15(26)5-7-19(17)28/h4-7,12-13,22,25-28H,1-3,8-11H2,(H,23,29)(H,24,30) | lld:chebi |
| chebi:CHEBI:64901 | skos:relatedSynonym | InChIKey=LOUWELXLLQURSP-UHFFFAOYSA-N | lld:chebi |