| chebi:CHEBI:63569 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:63569 | skos:definition | "The N-substituted diamine that is 1,4-phenylenediamine substituted at one N with an isopropyl group and at the other with a phenyl group." [] | lld:chebi |
| chebi:CHEBI:63569 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:63569 | skos:prefLabel | N-isopropyl-N'-phenyl-p-phenylenediamine | lld:chebi |
| chebi:CHEBI:63569 | skos:altLabel | N-isopropyl-N'-phenylbenzene-1,4-diamine | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:21616561 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:19338586 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | NIST Chemistry WebBook:101-72-4 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | Reaxys:2213195 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:8156758 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | ChemIDplus:101-72-4 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:8462307 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:8384542 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:notation | CiteXplore:7204095 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63569 | skos:broader | chebi:CHEBI:50441 | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | N-(1-methylethyl)-N'-phenyl-1,4-benzenediamine | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | 4-(Isopropylamino)diphenylamine | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | 4-Anilino-N-isopropylaniline | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | -Isopropylaminodiphenylamine | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | N-isopropyl-N'-phenyl-1,4-phenylenediamine | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | IPPD | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | C15H18N2 | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | CC(C)Nc1ccc(Nc2ccccc2)cc1 | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | InChI=1S/C15H18N2/c1-12(2)16-14-8-10-15(11-9-14)17-13-6-4-3-5-7-13/h3-12,16-17H,1-2H3 | lld:chebi |
| chebi:CHEBI:63569 | skos:relatedSynonym | InChIKey=OUBMGJOQLXMSNT-UHFFFAOYSA-N | lld:chebi |
