Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:63081
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:63081 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:63081 | skos:definition | "An N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide in which both of the stereocentres have S configuration." [] | lld:chebi |
| chebi:CHEBI:63081 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:63081 | skos:prefLabel | (S,S)-formoterol | lld:chebi |
| chebi:CHEBI:63081 | skos:altLabel | N-{2-hydroxy-5-[(1S)-1-hydroxy-2-{[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide | lld:chebi |
| chebi:CHEBI:63081 | skos:notation | Reaxys:7861826 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:63081 | skos:broader | chebi:CHEBI:63082 | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | C19H24N2O4 | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | (+)-formoterol | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | (S,S)-N-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formaldehyde | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | [H]C(=O)Nc1cc(ccc1O)[C@H](O)CN[C@@H](C)Cc1ccc(OC)cc1 | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | InChI=1S/C19H24N2O4/c1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22/h3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22)/t13-,19+/m0/s1 | lld:chebi |
| chebi:CHEBI:63081 | skos:relatedSynonym | InChIKey=BPZSYCZIITTYBL-ORAYPTAESA-N | lld:chebi |