chebi:CHEBI:62947 | rdf:type | skos:Concept | lld:chebi |
chebi:CHEBI:62947 | skos:definition | "An ammonium salt obtained by reaction of ammonia with acetic acid. A deliquescent white crystalline solid, it has a relatively low melting point (114degreeC) for a salt." [] | lld:chebi |
chebi:CHEBI:62947 | skos:inScheme | lld:chebi | lld:chebi |
chebi:CHEBI:62947 | skos:prefLabel | ammonium acetate | lld:chebi |
chebi:CHEBI:62947 | skos:altLabel | ammonium acetate | lld:chebi |
chebi:CHEBI:62947 | skos:notation | Reaxys:10774525 "Reaxys Registry Number" | lld:chebi |
chebi:CHEBI:62947 | skos:notation | ChemIDplus:631-61-8 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:62947 | skos:notation | Wikipedia:Ammonium_acetate "Wikipedia" | lld:chebi |
chebi:CHEBI:62947 | skos:notation | Reaxys:3564799 "Reaxys Registry Number" | lld:chebi |
chebi:CHEBI:62947 | skos:notation | CiteXplore:1180897 "PubMed citation" | lld:chebi |
chebi:CHEBI:62947 | skos:broader | chebi:CHEBI:47704 | lld:chebi |
chebi:CHEBI:62947 | skos:broader | chebi:CHEBI:59230 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | NH4OAc | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | CH3CO2NH4 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | acetic acid, ammonium salt | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | CH3COONH4 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | AcONH4 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | azanium acetate | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | ammonium ethanoate | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | C2H7NO2 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | [NH4+].CC([O-])=O | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 | lld:chebi |
chebi:CHEBI:62947 | skos:relatedSynonym | InChIKey=USFZMSVCRYTOJT-UHFFFAOYSA-N | lld:chebi |