| chebi:CHEBI:50693 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:50693 | skos:definition | "A member of the class of bipyridines that is 2-pyridone which is substituted at positions 3, 5, and 6 by cyano, pyrid-4-yl, and methyl groups, respectively. It is used (particularly intravenously, as the lactate) for the short-term management of severe heart failure." [] | lld:chebi |
| chebi:CHEBI:50693 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:50693 | skos:prefLabel | milrinone | lld:chebi |
| chebi:CHEBI:50693 | skos:altLabel | 2-methyl-6-oxo-1,6-dihydro-3,4'-bipyridine-5-carbonitrile | lld:chebi |
| chebi:CHEBI:50693 | skos:altLabel | Milrinone | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | DrugBank:DB00235 "DrugBank" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | CiteXplore:21905056 "PubMed citation" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | CiteXplore:14638547 "PubMed citation" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | CiteXplore:14624413 "PubMed citation" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Wikipedia:Milrinone "Wikipedia" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | CiteXplore:10634314 "PubMed citation" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Reaxys:3546821 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | CiteXplore:21971319 "PubMed citation" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | ChemIDplus:78415-72-2 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | KEGG COMPOUND:C07224 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Patent:US4313951 "Patent" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Patent:US4413127 "Patent" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | KEGG DRUG:D00417 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Patent:BE886336 "Patent" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | Beilstein:3546821 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:50693 | skos:notation | PDBeChem:MIL "PDBeChem" | lld:chebi |
| chebi:CHEBI:50693 | skos:broader | chebi:CHEBI:18379 | lld:chebi |
| chebi:CHEBI:50693 | skos:broader | chebi:CHEBI:50511 | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | milrinone | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | milrinonum | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | 1,6-Dihydro-2-methyl-6-oxo(3,4'-bipyridine)-5-carbonitrile | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | milrinona | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | C12H9N3O | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | Cc1[nH]c(=O)c(cc1-c1ccncc1)C#N | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) | lld:chebi |
| chebi:CHEBI:50693 | skos:relatedSynonym | InChIKey=PZRHRDRVRGEVNW-UHFFFAOYSA-N | lld:chebi |
