Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:3997
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:3997 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:3997 | skos:definition | "The hydrochloride salt of cyclobenzaprine. A centrally acting skeletal muscle relaxant, it is used in the symptomatic treatment of painful muscle spasm." [] | lld:chebi |
| chebi:CHEBI:3997 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:3997 | skos:prefLabel | cyclobenzaprine hydrochloride | lld:chebi |
| chebi:CHEBI:3997 | skos:altLabel | 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine hydrochloride | lld:chebi |
| chebi:CHEBI:3997 | skos:altLabel | 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine hydrochloride | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | ChemIDplus:6202-23-9 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | DrugBank:DB00924 "DrugBank" | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | KEGG DRUG:6202-23-9 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | Patent:FR2100873 "Patent" | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | KEGG DRUG:D00772 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:3997 | skos:notation | Beilstein:6247987 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:3997 | skos:broader | chebi:CHEBI:36807 | lld:chebi |
| chebi:CHEBI:3997 | skos:broader | chebi:CHEBI:36809 | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | cyclobenzaprine HCl | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Delta(5,gamma)-propylamine hydrochloride | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | C20H22ClN | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | Cl.CN(C)CCC=C1c2ccccc2C=Cc2ccccc12 | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | InChI=1S/C20H21N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-14H,7,15H2,1-2H3;1H | lld:chebi |
| chebi:CHEBI:3997 | skos:relatedSynonym | InChIKey=VXEAYBOGHINOKW-UHFFFAOYSA-N | lld:chebi |