Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:3996
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:3996 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:3996 | skos:definition | "5-Methylidene-5H-dibenzo[a,d]cycloheptene in which one of the hydrogens of the methylidene group is substituted by a 2-(dimethylamino)ethyl group. A centrally acting skeletal muscle relaxant, it is used as its hydrochloride salt in the symptomatic treatment of painful muscle spasm." [] | lld:chebi |
| chebi:CHEBI:3996 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:3996 | skos:prefLabel | cyclobenzaprine | lld:chebi |
| chebi:CHEBI:3996 | skos:altLabel | Cyclobenzaprine | lld:chebi |
| chebi:CHEBI:3996 | skos:altLabel | 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine | lld:chebi |
| chebi:CHEBI:3996 | skos:altLabel | 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | DrugBank:DB00924 "DrugBank" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | ChEMBL:17725338 "PubMed citation" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | Patent:GB858187 "Patent" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | KEGG COMPOUND:303-53-7 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | Wikipedia:Cyclobenzaprine "Wikipedia" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | KEGG DRUG:D07758 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | Beilstein:2126383 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | NIST Chemistry WebBook:303-53-7 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | KEGG COMPOUND:C06931 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:3996 | skos:notation | ChEMBL:18027916 "PubMed citation" | lld:chebi |
| chebi:CHEBI:3996 | skos:broader | chebi:CHEBI:36809 | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | cyclobenzaprine | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | ciclobenzaprina | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | cyclobenzaprinum | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Delta(5,gamma)-propylamine | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | (3-Dibenzo[a,d]cyclohepten-5-ylidene-propyl)-dimethyl-amine | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | C20H21N | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | CN(C)CCC=C1c2ccccc2C=Cc2ccccc12 | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | InChI=1S/C20H21N/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-14H,7,15H2,1-2H3 | lld:chebi |
| chebi:CHEBI:3996 | skos:relatedSynonym | InChIKey=JURKNVYFZMSNLP-UHFFFAOYSA-N | lld:chebi |