| chebi:CHEBI:39912 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:39912 | skos:definition | "A dihydroxybenzoic acid in which the hydroxy groups are located at positions 3 and 5." [] | lld:chebi |
| chebi:CHEBI:39912 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:39912 | skos:prefLabel | 3,5-dihydroxybenzoic acid | lld:chebi |
| chebi:CHEBI:39912 | skos:altLabel | 3,5-dihydroxybenzoic acid | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | CiteXplore:22770225 "PubMed citation" | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | ChemIDplus:99-10-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | Reaxys:2207864 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | MetaCyc:CPD0-1274 "MetaCyc" | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | HMDB:HMDB13677 "HMDB" | lld:chebi |
| chebi:CHEBI:39912 | skos:notation | Wikipedia:3\,5-Dihydroxybenzoic_acid "Wikipedia" | lld:chebi |
| chebi:CHEBI:39912 | skos:broader | chebi:CHEBI:33572 | lld:chebi |
| chebi:CHEBI:39912 | skos:broader | chebi:CHEBI:23778 | lld:chebi |
| chebi:CHEBI:39912 | skos:relatedSynonym | C7H6O4 | lld:chebi |
| chebi:CHEBI:39912 | skos:relatedSynonym | alpha-Resorcylic acid | lld:chebi |
| chebi:CHEBI:39912 | skos:relatedSynonym | OC(=O)c1cc(O)cc(O)c1 | lld:chebi |
| chebi:CHEBI:39912 | skos:relatedSynonym | InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) | lld:chebi |
| chebi:CHEBI:39912 | skos:relatedSynonym | InChIKey=UYEMGAFJOZZIFP-UHFFFAOYSA-N | lld:chebi |
