| chebi:CHEBI:27981 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:27981 | skos:definition | "A 2-oxo monocarboxylic acid that is pyruvic acid in which one of the methyl hydrogens is substituted by a 3,5-dinitro-4-hydroxyphenyl group." [] | lld:chebi |
| chebi:CHEBI:27981 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:27981 | skos:prefLabel | 3,5-dinitro-4-hydroxyphenylpyruvic acid | lld:chebi |
| chebi:CHEBI:27981 | skos:altLabel | 3-(4-hydroxy-3,5-dinitrophenyl)-2-oxopropanoic acid | lld:chebi |
| chebi:CHEBI:27981 | skos:notation | KEGG COMPOUND:C04286 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:27981 | skos:broader | chebi:CHEBI:33853 | lld:chebi |
| chebi:CHEBI:27981 | skos:broader | chebi:CHEBI:35716 | lld:chebi |
| chebi:CHEBI:27981 | skos:broader | chebi:CHEBI:35910 | lld:chebi |
| chebi:CHEBI:27981 | skos:relatedSynonym | 3-(4-hydroxy-3,5-dinitrophenyl)-2-oxopropionic acid | lld:chebi |
| chebi:CHEBI:27981 | skos:relatedSynonym | C9H6N2O8 | lld:chebi |
| chebi:CHEBI:27981 | skos:relatedSynonym | OC(=O)C(=O)Cc1cc(c(O)c(c1)[N+]([O-])=O)[N+]([O-])=O | lld:chebi |
| chebi:CHEBI:27981 | skos:relatedSynonym | InChI=1S/C9H6N2O8/c12-7(9(14)15)3-4-1-5(10(16)17)8(13)6(2-4)11(18)19/h1-2,13H,3H2,(H,14,15) | lld:chebi |
| chebi:CHEBI:27981 | skos:relatedSynonym | InChIKey=AIXYOVZVCBPJAR-UHFFFAOYSA-N | lld:chebi |
