Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:2380
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:2380 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:2380 | skos:definition | "The hydrochloride salt of acebutolol, prepared using equimolar amounts of acebutolol and hydrogen chloride." [] | lld:chebi |
| chebi:CHEBI:2380 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:2380 | skos:prefLabel | acebutolol hydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:altLabel | Acebutolol hydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:altLabel | N-{3-acetyl-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}butanamide hydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | ChemIDplus:34381-68-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | Beilstein:6080568 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | DrugBank:DB01193 "DrugBank" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | KEGG COMPOUND:34381-68-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | KEGG DRUG:D00597 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | KEGG COMPOUND:C07677 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:2380 | skos:notation | Gmelin:2181029 "Gmelin Registry Number" | lld:chebi |
| chebi:CHEBI:2380 | skos:broader | chebi:CHEBI:36807 | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | (+-)-3'-acetyl-4'-(2-hydroxy-3-(isopropylamino)propoxy)butyranilide monohydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | Neptal | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | Sectral | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | dl-1-(2-acetyl-4-butyramidophenoxy)-2-hydroxy-3-isopropylaminopropane hydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | 3'-acetyl-4'-(2-hydroxy-3-(isopropylamino)propoxy)butyranilide hydrochloride | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | Prent | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | C18H28N2O4.HCl | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | Cl[H].CCCC(=O)Nc1ccc(OCC(O)CNC(C)C)c(c1)C(C)=O | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | InChI=1S/C18H28N2O4.ClH/c1-5-6-18(23)20-14-7-8-17(16(9-14)13(4)21)24-11-15(22)10-19-12(2)3;/h7-9,12,15,19,22H,5-6,10-11H2,1-4H3,(H,20,23);1H | lld:chebi |
| chebi:CHEBI:2380 | skos:relatedSynonym | InChIKey=KTUFKADDDORSSI-UHFFFAOYSA-N | lld:chebi |