| chebi:CHEBI:18257 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:18257 | skos:definition | "An alpha-amino acid that is pentanoic acid bearing two amino substituents at positions 2 and 5." [] | lld:chebi |
| chebi:CHEBI:18257 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:18257 | skos:prefLabel | ornithine | lld:chebi |
| chebi:CHEBI:18257 | skos:altLabel | ornithine | lld:chebi |
| chebi:CHEBI:18257 | skos:altLabel | 2,5-diaminopentanoic acid | lld:chebi |
| chebi:CHEBI:18257 | skos:altLabel | Ornithine | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | CiteXplore:17190852 "PubMed citation" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | CiteXplore:22264337 "PubMed citation" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | Beilstein:1722296 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | Reaxys:1722296 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | ChemIDplus:616-07-9 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | Gmelin:847696 "Gmelin Registry Number" | lld:chebi |
| chebi:CHEBI:18257 | skos:notation | KEGG COMPOUND:C01602 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:18257 | skos:broader | chebi:CHEBI:33704 | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | Orn | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | C5H12N2O2 | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | DL-Ornithine | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | 2,5-Diaminovaleric acid | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | 2,5-Diaminopentanoic acid | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | NCCCC(N)C(O)=O | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) | lld:chebi |
| chebi:CHEBI:18257 | skos:relatedSynonym | InChIKey=AHLPHDHHMVZTML-UHFFFAOYSA-N | lld:chebi |
| chebi:CHEBI:16176 | skos:broader | chebi:CHEBI:18257 | lld:chebi |
| chebi:CHEBI:15729 | skos:broader | chebi:CHEBI:18257 | lld:chebi |
