chebi:CHEBI:164200 | rdf:type | skos:Concept | lld:chebi |
chebi:CHEBI:164200 | skos:definition | "An aromatic ether that is phenol which is substituted at C-5 by a chloro group and at C-2 by a 2,4-dichlorophenoxy group. It is widely used as a preservative and antimicrobial agent in personal care products such as soaps, skin creams, toothpaste and deodorants as well as in household items such as plastic chopping boards, sports equipment and shoes." [] | lld:chebi |
chebi:CHEBI:164200 | skos:inScheme | lld:chebi | lld:chebi |
chebi:CHEBI:164200 | skos:prefLabel | triclosan | lld:chebi |
chebi:CHEBI:164200 | skos:altLabel | 5-chloro-2-(2,4-dichlorophenoxy)phenol | lld:chebi |
chebi:CHEBI:164200 | skos:altLabel | Triclosan | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:18837732 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | DrugBank:DB08604 "DrugBank" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | ChemIDplus:3380-34-5 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Wikipedia:Triclosan "Wikipedia" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:22561896 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:21094257 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:22105314 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Beilstein:2057142 "Beilstein Registry Number" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Patent:US3629477 "Patent" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:21833630 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Reaxys:2057142 "Reaxys Registry Number" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | KEGG DRUG:D06226 "KEGG DRUG" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Patent:US3506720 "Patent" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | CiteXplore:21166831 "PubMed citation" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | Patent:NL6401526 "Patent" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | KEGG COMPOUND:3380-34-5 "CAS Registry Number" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | KEGG COMPOUND:C12059 "KEGG COMPOUND" | lld:chebi |
chebi:CHEBI:164200 | skos:notation | PDBeChem:TCL "PDBeChem" | lld:chebi |
chebi:CHEBI:164200 | skos:broader | chebi:CHEBI:36683 | lld:chebi |
chebi:CHEBI:164200 | skos:broader | chebi:CHEBI:33853 | lld:chebi |
chebi:CHEBI:164200 | skos:broader | chebi:CHEBI:35618 | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | triclosan | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | 2,4,4'-Trichloro-2'-hydroxydiphenyl ether | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | triclosanum | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | 5-Chloro-2-(2,4-dichloro-phenoxy)-phenol | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | C12H7Cl3O2 | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H | lld:chebi |
chebi:CHEBI:164200 | skos:relatedSynonym | InChIKey=XEFQLINVKFYRCS-UHFFFAOYSA-N | lld:chebi |