| chebi:CHEBI:119915 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:119915 | skos:definition | "The carboxamide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid." [] | lld:chebi |
| chebi:CHEBI:119915 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:119915 | skos:prefLabel | fentanyl | lld:chebi |
| chebi:CHEBI:119915 | skos:altLabel | N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide | lld:chebi |
| chebi:CHEBI:119915 | skos:altLabel | FENTANYL | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | ChEMBL:11585443 "PubMed citation" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | DrugBank:DB00813 "DrugBank" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | CiteXplore:16621415 "PubMed citation" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | Wikipedia:Fentanyl "Wikipedia" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | Patent:US3164600 "Patent" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | Reaxys:494484 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | ChEMBL:14698188 "PubMed citation" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | Patent:FR1344366 "Patent" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | KEGG DRUG:D00320 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | KEGG DRUG:437-38-7 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | ChemIDplus:437-38-7 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | ChEMBL:10987438 "PubMed citation" | lld:chebi |
| chebi:CHEBI:119915 | skos:notation | ChEMBL:10669565 "PubMed citation" | lld:chebi |
| chebi:CHEBI:119915 | skos:broader | chebi:CHEBI:26151 | lld:chebi |
| chebi:CHEBI:119915 | skos:broader | chebi:CHEBI:37622 | lld:chebi |
| chebi:CHEBI:119915 | skos:broader | chebi:CHEBI:13248 | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | fentanyl | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-(1-Phenethyl-piperidin-4-yl)-N-phenyl-propionamide | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | fentanylum | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | 1-phenethyl-4-(N-phenylpropionamido)piperidine | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | fentanila | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-(1-phenethyl-4-piperidinyl)-N-phenylpropionamide | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-phenethyl-4-(N-propionylanilino)piperidine | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-(1-phenethyl-4-piperidyl)propionanilide | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | 1-phenethyl-4-N-propionylanilinopiperidine | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | C22H28N2O | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | CCC(=O)N(C1CCN(CC1)CCc1ccccc1)c1ccccc1 | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | InChI=1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 | lld:chebi |
| chebi:CHEBI:119915 | skos:relatedSynonym | InChIKey=PJMPHNIQZUBGLI-UHFFFAOYSA-N | lld:chebi |
