| chebi:CHEBI:76 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:76 | skos:definition | "An isoquinoline alkaloid that exhibits anti-cancer, trypanocidal and antiplasmodial activites." [] | lld:chebi |
| chebi:CHEBI:76 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:76 | skos:prefLabel | (-)-annonaine | lld:chebi |
| chebi:CHEBI:76 | skos:altLabel | (7aR)-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline | lld:chebi |
| chebi:CHEBI:76 | skos:altLabel | (-)-Annonaine | lld:chebi |
| chebi:CHEBI:76 | skos:notation | CiteXplore:18305432 "PubMed citation" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | Reaxys:90236 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | KEGG COMPOUND:C09339 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | CiteXplore:21361287 "PubMed citation" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | CiteXplore:20826204 "PubMed citation" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | HMDB:HMDB30348 "HMDB" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | CiteXplore:22101086 "PubMed citation" | lld:chebi |
| chebi:CHEBI:76 | skos:notation | KEGG COMPOUND:1862-41-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:76 | skos:broader | chebi:CHEBI:38164 | lld:chebi |
| chebi:CHEBI:76 | skos:broader | chebi:CHEBI:24921 | lld:chebi |
| chebi:CHEBI:76 | skos:broader | chebi:CHEBI:24922 | lld:chebi |
| chebi:CHEBI:76 | skos:broader | chebi:CHEBI:38104 | lld:chebi |
| chebi:CHEBI:76 | skos:relatedSynonym | Anonaine | lld:chebi |
| chebi:CHEBI:76 | skos:relatedSynonym | C17H15NO2 | lld:chebi |
| chebi:CHEBI:76 | skos:relatedSynonym | [H][C@]12Cc3ccccc3-c3c4OCOc4cc(CCN1)c23 | lld:chebi |
| chebi:CHEBI:76 | skos:relatedSynonym | InChI=1S/C17H15NO2/c1-2-4-12-10(3-1)7-13-15-11(5-6-18-13)8-14-17(16(12)15)20-9-19-14/h1-4,8,13,18H,5-7,9H2/t13-/m1/s1 | lld:chebi |
| chebi:CHEBI:76 | skos:relatedSynonym | InChIKey=VZTUKBKUWSHDFM-CYBMUJFWSA-N | lld:chebi |
