Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:66248
Subject | Predicate | Object | Context |
---|---|---|---|
chebi:CHEBI:66248 | rdf:type | skos:Concept | lld:chebi |
chebi:CHEBI:66248 | skos:definition | "A 17-membered macrocyclic lactam that incorporates a phenol and a substituted indole moiety. It includes a R-hydroxy group at position 11 and a (3-methyl-2-oxopentanoyl)amino group at position at position 18 with a S-methyl group. It acts as a proteasome inhibitor and is obtained from Apiospora montagnei Sacc. TC 1093, isolated from a soil sample." [] | lld:chebi |
chebi:CHEBI:66248 | skos:inScheme | lld:chebi | lld:chebi |
chebi:CHEBI:66248 | skos:prefLabel | TMC-95D | lld:chebi |
chebi:CHEBI:66248 | skos:altLabel | (10S,11S,12S,15S,18S)-15-(2-amino-2-oxoethyl)-10,11,23-trihydroxy-18-{[(3R)-3-methyl-2-oxopentanoyl]amino}-9,14,17-trioxo-N-[(1Z)-prop-1-en-1-yl]-8,13,16-triazatetracyclo[18.3.1.0(2,7).0(6,10)]tetracosa-1(24),2,4,6,20,22-hexaene-12-carboxamide | lld:chebi |
chebi:CHEBI:66248 | skos:notation | CiteXplore:10814045 "PubMed citation" | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:26878 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:35681 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:37622 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:33853 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:24828 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:51026 | lld:chebi |
chebi:CHEBI:66248 | skos:broader | chebi:CHEBI:24995 | lld:chebi |
chebi:CHEBI:66248 | skos:relatedSynonym | C33H38N6O10 | lld:chebi |
chebi:CHEBI:66248 | skos:relatedSynonym | CC[C@@H](C)C(=O)C(=O)N[C@H]1Cc2ccc(O)c(c2)-c2cccc3c2NC(=O)[C@@]3(O)[C@@H](O)[C@H](NC(=O)[C@H](CC(N)=O)NC1=O)C(=O)N\\C=C/C | lld:chebi |
chebi:CHEBI:66248 | skos:relatedSynonym | InChI=1S/C33H38N6O10/c1-4-11-35-30(46)25-27(43)33(49)19-8-6-7-17(24(19)39-32(33)48)18-12-16(9-10-22(18)40)13-20(37-31(47)26(42)15(3)5-2)28(44)36-21(14-23(34)41)29(45)38-25/h4,6-12,15,20-21,25,27,40,43,49H,5,13-14H2,1-3H3,(H2,34,41)(H,35,46)(H,36,44)(H,37,47)(H,38,45)(H,39,48)/b11-4-/t15-,20+,21+,25+,27+,33+/m1/s1 | lld:chebi |
chebi:CHEBI:66248 | skos:relatedSynonym | InChIKey=ZIAXNZCTODBCKW-WYRJOJSMSA-N | lld:chebi |