Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:66042
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:66042 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:66042 | skos:definition | "An organic heterotetracyclic compound isolated from the culture broth of Micromonospora sp. SA-246. It exhibits potent antibacterial activity against several Gram-positive bacterial strains." [] | lld:chebi |
| chebi:CHEBI:66042 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:66042 | skos:prefLabel | 1-hydroxycrisamicin A | lld:chebi |
| chebi:CHEBI:66042 | skos:altLabel | (3aS,3a'S,5S,5'S,11bS,11b'S)-5,10,10'-trihydroxy-5,5'-dimethyl-3,3',3a,3a',5,5',11b,11b'-octahydro-2H,2'H-8,8'-bibenzo[g]furo[3,2-c]isochromene-2,2',6,6',11,11'-hexone | lld:chebi |
| chebi:CHEBI:66042 | skos:notation | CiteXplore:9531992 "PubMed citation" | lld:chebi |
| chebi:CHEBI:66042 | skos:notation | Reaxys:8180397 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:66042 | skos:broader | chebi:CHEBI:38163 | lld:chebi |
| chebi:CHEBI:66042 | skos:broader | chebi:CHEBI:33853 | lld:chebi |
| chebi:CHEBI:66042 | skos:broader | chebi:CHEBI:36141 | lld:chebi |
| chebi:CHEBI:66042 | skos:broader | chebi:CHEBI:37581 | lld:chebi |
| chebi:CHEBI:66042 | skos:broader | chebi:CHEBI:37406 | lld:chebi |
| chebi:CHEBI:66042 | skos:relatedSynonym | C32H22O13 | lld:chebi |
| chebi:CHEBI:66042 | skos:relatedSynonym | [H][C@]12CC(=O)O[C@@]1([H])C1=C([C@H](C)O2)C(=O)c2cc(cc(O)c2C1=O)-c1cc(O)c2C(=O)C3=C(C(=O)c2c1)[C@@](C)(O)O[C@@]1([H])CC(=O)O[C@@]31[H] | lld:chebi |
| chebi:CHEBI:66042 | skos:relatedSynonym | InChI=1S/C32H22O13/c1-9-20-23(30-16(42-9)7-18(35)43-30)28(39)21-12(26(20)37)3-10(5-14(21)33)11-4-13-22(15(34)6-11)29(40)24-25(27(13)38)32(2,41)45-17-8-19(36)44-31(17)24/h3-6,9,16-17,30-31,33-34,41H,7-8H2,1-2H3/t9-,16-,17-,30+,31+,32-/m0/s1 | lld:chebi |
| chebi:CHEBI:66042 | skos:relatedSynonym | InChIKey=RGOCVNGEBMGCNA-WIDQCZIUSA-N | lld:chebi |