Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:65410
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:65410 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:65410 | skos:definition | "A lignan that consists of buta-1,3-diene substituted by a 2,4-dihydroxybenzyl group at position 2 and a 1,3-benzodioxol-5-ylmethyl group at position 3. It is isolated from the ground stems of Anogeissus acuminata and exhibits anti-HIV activity by inhibiting HIV-1 reverse transcriptase enzyme." [] | lld:chebi |
| chebi:CHEBI:65410 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:65410 | skos:prefLabel | anolignan A | lld:chebi |
| chebi:CHEBI:65410 | skos:altLabel | 4-[3-(1,3-benzodioxol-5-ylmethyl)-2-methylidenebut-3-en-1-yl]benzene-1,3-diol | lld:chebi |
| chebi:CHEBI:65410 | skos:notation | ChemIDplus:158081-97-1 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:65410 | skos:notation | Reaxys:8578143 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:65410 | skos:notation | CiteXplore:11777463 "PubMed citation" | lld:chebi |
| chebi:CHEBI:65410 | skos:notation | CiteXplore:7525878 "PubMed citation" | lld:chebi |
| chebi:CHEBI:65410 | skos:broader | chebi:CHEBI:33572 | lld:chebi |
| chebi:CHEBI:65410 | skos:broader | chebi:CHEBI:38298 | lld:chebi |
| chebi:CHEBI:65410 | skos:broader | chebi:CHEBI:25036 | lld:chebi |
| chebi:CHEBI:65410 | skos:relatedSynonym | 2-(2',4'-dihydroxybenzyl)-3-(3'',4''-methylenedioxybenzyl)- 1,3-butadiene | lld:chebi |
| chebi:CHEBI:65410 | skos:relatedSynonym | C19H18O4 | lld:chebi |
| chebi:CHEBI:65410 | skos:relatedSynonym | Oc1ccc(CC(=C)C(=C)Cc2ccc3OCOc3c2)c(O)c1 | lld:chebi |
| chebi:CHEBI:65410 | skos:relatedSynonym | InChI=1S/C19H18O4/c1-12(7-14-3-6-18-19(9-14)23-11-22-18)13(2)8-15-4-5-16(20)10-17(15)21/h3-6,9-10,20-21H,1-2,7-8,11H2 | lld:chebi |
| chebi:CHEBI:65410 | skos:relatedSynonym | InChIKey=HFSAUGRJONZEDN-UHFFFAOYSA-N | lld:chebi |