Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:63200
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:63200 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:63200 | skos:definition | "A dipeptide consisting of N-butyl-L-serinamide having an (R)-2-amino-2-(4-hydroxyphenyl)acetyl residue attached to its alpha-amino nitrogen." [] | lld:chebi |
| chebi:CHEBI:63200 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:63200 | skos:prefLabel | N(2)-[(R)-2-amino-2-(4-hydroxyphenyl)acetyl]-N-butyl-L-serinamide | lld:chebi |
| chebi:CHEBI:63200 | skos:altLabel | N(2)-[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]-N-butyl-L-serinamide | lld:chebi |
| chebi:CHEBI:63200 | skos:notation | CiteXplore:21425867 "PubMed citation" | lld:chebi |
| chebi:CHEBI:63200 | skos:broader | chebi:CHEBI:26649 | lld:chebi |
| chebi:CHEBI:63200 | skos:broader | chebi:CHEBI:46761 | lld:chebi |
| chebi:CHEBI:63200 | skos:relatedSynonym | C15H23N3O4 | lld:chebi |
| chebi:CHEBI:63200 | skos:relatedSynonym | CCCCNC(=O)[C@H](CO)NC(=O)[C@H](N)c1ccc(O)cc1 | lld:chebi |
| chebi:CHEBI:63200 | skos:relatedSynonym | InChI=1S/C15H23N3O4/c1-2-3-8-17-14(21)12(9-19)18-15(22)13(16)10-4-6-11(20)7-5-10/h4-7,12-13,19-20H,2-3,8-9,16H2,1H3,(H,17,21)(H,18,22)/t12-,13+/m0/s1 | lld:chebi |
| chebi:CHEBI:63200 | skos:relatedSynonym | InChIKey=KYIHERVMDNDRBE-QWHCGFSZSA-N | lld:chebi |