Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:59246
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:59246 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:59246 | skos:definition | "An organochlorine pesticide consisting of 1,3-diphenylurea having chloro substituents at the 3-, 4- and 5'-positions and a 4-chloro-2-sulfophenoxy group at the 2'-position." [] | lld:chebi |
| chebi:CHEBI:59246 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:59246 | skos:prefLabel | sulcofuron | lld:chebi |
| chebi:CHEBI:59246 | skos:altLabel | 5-chloro-2-(4-chloro-2-{[(3,4-dichlorophenyl)carbamoyl]amino}phenoxy)benzenesulfonic acid | lld:chebi |
| chebi:CHEBI:59246 | skos:notation | CiteXplore:8841454 "PubMed citation" | lld:chebi |
| chebi:CHEBI:59246 | skos:notation | Beilstein:3517243 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:59246 | skos:notation | ChemIDplus:24019-05-4 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:59246 | skos:broader | chebi:CHEBI:47857 | lld:chebi |
| chebi:CHEBI:59246 | skos:broader | chebi:CHEBI:33555 | lld:chebi |
| chebi:CHEBI:59246 | skos:broader | chebi:CHEBI:38656 | lld:chebi |
| chebi:CHEBI:59246 | skos:relatedSynonym | C19H12Cl4N2O5S | lld:chebi |
| chebi:CHEBI:59246 | skos:relatedSynonym | OS(=O)(=O)c1cc(Cl)ccc1Oc1ccc(Cl)cc1NC(=O)Nc1ccc(Cl)c(Cl)c1 | lld:chebi |
| chebi:CHEBI:59246 | skos:relatedSynonym | InChI=1S/C19H12Cl4N2O5S/c20-10-1-5-16(30-17-6-2-11(21)8-18(17)31(27,28)29)15(7-10)25-19(26)24-12-3-4-13(22)14(23)9-12/h1-9H,(H2,24,25,26)(H,27,28,29) | lld:chebi |
| chebi:CHEBI:59246 | skos:relatedSynonym | InChIKey=MKUMTCOTMQPYTQ-UHFFFAOYSA-N | lld:chebi |