| chebi:CHEBI:59242 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:59242 | skos:definition | "A urea derivative having two 4-chloro-3-(trifluoromethyl)phenyl substituents at the N-1 and N-3 positions." [] | lld:chebi |
| chebi:CHEBI:59242 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:59242 | skos:prefLabel | flucofuron | lld:chebi |
| chebi:CHEBI:59242 | skos:altLabel | 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]urea | lld:chebi |
| chebi:CHEBI:59242 | skos:notation | CiteXplore:8841454 "PubMed citation" | lld:chebi |
| chebi:CHEBI:59242 | skos:notation | ChemIDplus:370-50-3 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:59242 | skos:notation | Beilstein:2189316 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:59242 | skos:broader | chebi:CHEBI:47857 | lld:chebi |
| chebi:CHEBI:59242 | skos:broader | chebi:CHEBI:38656 | lld:chebi |
| chebi:CHEBI:59242 | skos:broader | chebi:CHEBI:38805 | lld:chebi |
| chebi:CHEBI:59242 | skos:relatedSynonym | 1,3-Bis(4-chloro-alpha,alpha,alpha-trifluoro-m-tolyl)urea | lld:chebi |
| chebi:CHEBI:59242 | skos:relatedSynonym | C15H8Cl2F6N2O | lld:chebi |
| chebi:CHEBI:59242 | skos:relatedSynonym | FC(F)(F)c1cc(NC(=O)Nc2ccc(Cl)c(c2)C(F)(F)F)ccc1Cl | lld:chebi |
| chebi:CHEBI:59242 | skos:relatedSynonym | InChI=1S/C15H8Cl2F6N2O/c16-11-3-1-7(5-9(11)14(18,19)20)24-13(26)25-8-2-4-12(17)10(6-8)15(21,22)23/h1-6H,(H2,24,25,26) | lld:chebi |
| chebi:CHEBI:59242 | skos:relatedSynonym | InChIKey=ABOVRDBEJDIBMZ-UHFFFAOYSA-N | lld:chebi |
