| chebi:CHEBI:53051 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:53051 | skos:definition | "A thiocyanate compound having a 2,4-dinitrophenyl group attached to the sulfur atom." [] | lld:chebi |
| chebi:CHEBI:53051 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:53051 | skos:prefLabel | 2,4-dinitro-1-thiocyanatobenzene | lld:chebi |
| chebi:CHEBI:53051 | skos:altLabel | 2,4-dinitrophenyl thiocyanate | lld:chebi |
| chebi:CHEBI:53051 | skos:notation | CiteXplore:8466279 "PubMed citation" | lld:chebi |
| chebi:CHEBI:53051 | skos:notation | Beilstein:1983292 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:53051 | skos:notation | ChemIDplus:1594-56-5 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:53051 | skos:notation | CiteXplore:58832 "PubMed citation" | lld:chebi |
| chebi:CHEBI:53051 | skos:broader | chebi:CHEBI:35716 | lld:chebi |
| chebi:CHEBI:53051 | skos:broader | chebi:CHEBI:26955 | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitrothiocyanobenzene | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitro-rhodanbenzol | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitrothiocyanatebenzene | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitrothiocyanatobenzene | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitro-1-thiocyanobenzene | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitrophenyl thiocyanate | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | DNTB | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | 2,4-Dinitrophenylthiocyanate | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | C7H3N3O4S | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | [O-][N+](=O)c1ccc(SC#N)c(c1)[N+]([O-])=O | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | InChI=1S/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H | lld:chebi |
| chebi:CHEBI:53051 | skos:relatedSynonym | InChIKey=XQDQRCRASHAZBA-UHFFFAOYSA-N | lld:chebi |
