| chebi:CHEBI:28249 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:28249 | skos:definition | "A dicarboxylic acid that is cis,cis-muconic acid in which the hydrogens at positions 2 and 5 are substituted by hydroxy and methyl groups, respectively." [] | lld:chebi |
| chebi:CHEBI:28249 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:28249 | skos:prefLabel | 2-hydroxy-5-methyl-cis,cis-muconic acid | lld:chebi |
| chebi:CHEBI:28249 | skos:notation | Reaxys:1777634 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:28249 | skos:notation | KEGG COMPOUND:C07478 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:28249 | skos:broader | chebi:CHEBI:35692 | lld:chebi |
| chebi:CHEBI:28249 | skos:broader | chebi:CHEBI:33823 | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | C7H8O5 | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | (2E,4Z)-5-methyl-2-hydroxy-2,4-hexadiene-1,6-dioic acid | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | (2E,4Z)-2-hydroxy-5-methylhexa-2,4-dienedioic acid | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | C\\C(=C\\C=C(\\O)C(O)=O)C(O)=O | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | InChI=1S/C7H8O5/c1-4(6(9)10)2-3-5(8)7(11)12/h2-3,8H,1H3,(H,9,10)(H,11,12)/b4-2-,5-3+ | lld:chebi |
| chebi:CHEBI:28249 | skos:relatedSynonym | InChIKey=PQXOJASKFLIATD-VOERYJCWSA-N | lld:chebi |
