| chebi:CHEBI:28044 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:28044 | skos:definition | "An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group." [] | lld:chebi |
| chebi:CHEBI:28044 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:28044 | skos:prefLabel | phenylalanine | lld:chebi |
| chebi:CHEBI:28044 | skos:altLabel | phenylalanine | lld:chebi |
| chebi:CHEBI:28044 | skos:altLabel | 2-amino-3-phenylpropanoic acid | lld:chebi |
| chebi:CHEBI:28044 | skos:altLabel | Phenylalanine | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | CiteXplore:17439666 "PubMed citation" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | CiteXplore:22264337 "PubMed citation" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | Wikipedia:Phenylalanine "Wikipedia" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | ChemIDplus:150-30-1 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | Reaxys:1910407 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | Beilstein:1910407 "Beilstein Registry Number" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | Gmelin:50836 "Gmelin Registry Number" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | NIST Chemistry WebBook:150-30-1 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:28044 | skos:notation | KEGG COMPOUND:C02057 "KEGG COMPOUND" | lld:chebi |
| chebi:CHEBI:28044 | skos:broader | chebi:CHEBI:33704 | lld:chebi |
| chebi:CHEBI:28044 | skos:broader | chebi:CHEBI:33856 | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | F | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | C9H11NO2 | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | Phenylalanin | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | PHE | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | DL-Phenylalanine | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | fenilalanina | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | alpha-Amino-beta-phenylpropionic acid | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | NC(Cc1ccccc1)C(O)=O | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) | lld:chebi |
| chebi:CHEBI:28044 | skos:relatedSynonym | InChIKey=COLNVLDHVKWLRT-UHFFFAOYSA-N | lld:chebi |
| chebi:CHEBI:17295 | skos:broader | chebi:CHEBI:28044 | lld:chebi |
| chebi:CHEBI:16998 | skos:broader | chebi:CHEBI:28044 | lld:chebi |
