Source:http://linkedlifedata.com/resource/chebi/id/CHEBI:149226
| Subject | Predicate | Object | Context |
|---|---|---|---|
| chebi:CHEBI:149226 | rdf:type | skos:Concept | lld:chebi |
| chebi:CHEBI:149226 | skos:definition | "5-(1-Hydroxyethyl)benzene-1,3-diol in which one of the methyl hydrogens is replaced by a 1-(4-hydroxyphenyl)propan-2-amino group. A beta2-adrenergic agonist, it is used (as the hydrobromide salt) as a bronchodilator in the management of reversible airway obstruction." [] | lld:chebi |
| chebi:CHEBI:149226 | skos:inScheme | lld:chebi | lld:chebi |
| chebi:CHEBI:149226 | skos:prefLabel | fenoterol | lld:chebi |
| chebi:CHEBI:149226 | skos:altLabel | 5-(1-hydroxy-2-{[1-(4-hydroxyphenyl)propan-2-yl]amino}ethyl)benzene-1,3-diol | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | DrugBank:DB01288 "DrugBank" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | ChemIDplus:13392-18-2 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | KEGG DRUG:13392-18-2 "CAS Registry Number" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | ChEMBL:17845020 "PubMed citation" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | KEGG DRUG:D04157 "KEGG DRUG" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | Patent:US3341593 "Patent" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | Reaxys:2157041 "Reaxys Registry Number" | lld:chebi |
| chebi:CHEBI:149226 | skos:notation | Patent:BE640433 "Patent" | lld:chebi |
| chebi:CHEBI:149226 | skos:broader | chebi:CHEBI:35681 | lld:chebi |
| chebi:CHEBI:149226 | skos:broader | chebi:CHEBI:33853 | lld:chebi |
| chebi:CHEBI:149226 | skos:broader | chebi:CHEBI:50995 | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | fenoterol | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | phenoterol | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | 5-{1-Hydroxy-2-[2-(4-hydroxy-phenyl)-1-methyl-ethylamino]-ethyl}-benzene-1,3-diol | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | fenoterolum | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | 1-(p-hydroxyphenyl)-2-((beta-hydroxy-beta-(3',5'-dihydroxyphenyl))ethyl)aminopropane | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | 1-(3,5-dihydroxyphenyl)-1-hydroxy-2-((4-hydroxyphenyl)isopropylamino)ethane | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | 3,5-dihydroxy-alpha-(((p-hydroxy-alpha-methylphenethyl)amino)methyl)benzyl alcohol | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | C17H21NO4 | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | InChI=1S/C17H21NO4/c1-11(6-12-2-4-14(19)5-3-12)18-10-17(22)13-7-15(20)9-16(21)8-13/h2-5,7-9,11,17-22H,6,10H2,1H3 | lld:chebi |
| chebi:CHEBI:149226 | skos:relatedSynonym | InChIKey=LSLYOANBFKQKPT-UHFFFAOYSA-N | lld:chebi |